For research use only. Not for therapeutic Use.
NSC 66811(CAT: R061458) is a chemical compound with potential pharmacological effects that are not widely documented. NSC 66811’s specific mode of action and applications may not be well-established, suggesting that it might serve as a chemical intermediate, research tool, or reagent in various synthetic processes and experimental studies. Compounds like NSC 66811 often play roles in organic synthesis for creating more complex molecules, potentially for pharmaceuticals, agrochemicals, or other specialized applications.
CAS Number | 6964-62-1 |
Synonyms | 7-(α-Anilinobenzyl)-2-methyl-8-quinolinol |
Molecular Formula | C23H20N2O |
Purity | ≥95% |
Target | MDM-2/p53 |
Solubility | Soluble in DMSO > 10 mM |
Storage | Store at -20°C |
IUPAC Name | 7-[anilino(phenyl)methyl]-2-methylquinolin-8-ol |
InChI | InChI=1S/C23H20N2O/c1-16-12-13-18-14-15-20(23(26)22(18)24-16)21(17-8-4-2-5-9-17)25-19-10-6-3-7-11-19/h2-15,21,25-26H,1H3 |
InChIKey | WEENRMPCSWFMTE-UHFFFAOYSA-N |
SMILES | CC1=NC2=C(C=C1)C=CC(=C2O)C(C3=CC=CC=C3)NC4=CC=CC=C4 |