For research use only. Not for therapeutic Use.
NSC 694621（Cat No.:I043399）is a small molecule inhibitor that targets the protein kinase, which plays a critical role in cell survival, proliferation, and cancer progression. It is particularly studied for its potential in treating cancer by disrupting signaling pathways involved in tumor growth and metastasis. NSC 694621 has shown promising anti-cancer activity in preclinical models, demonstrating its ability to induce apoptosis and reduce tumor size. Research continues to explore its mechanisms and effectiveness across various cancer types, with the goal of advancing it into clinical trials for broader therapeutic use.
| CAS Number | 104857-29-6 |
| Synonyms | 2-(4-methoxyphenyl)-[1,2]thiazolo[5,4-b]pyridin-3-one |
| Molecular Formula | C13H10N2O2S |
| Purity | ≥95% |
| IUPAC Name | 2-(4-methoxyphenyl)-[1,2]thiazolo[5,4-b]pyridin-3-one |
| InChI | InChI=1S/C13H10N2O2S/c1-17-10-6-4-9(5-7-10)15-13(16)11-3-2-8-14-12(11)18-15/h2-8H,1H3 |
| InChIKey | AZVIMHSUSDTTCB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=O)C3=C(S2)N=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
