For research use only. Not for therapeutic Use.
NSC 694623（Cat No.:I043398）is a small molecule inhibitor known for its potential in cancer research. It selectively targets specific protein kinases involved in tumor progression and cell survival. By inhibiting these kinases, NSC 694623 can suppress cancer cell proliferation and induce apoptosis, making it a promising candidate for therapeutic development. Its effectiveness has been explored in various cancer types, showing significant anti-tumor activity in preclinical models. Ongoing studies aim to further elucidate its mechanism of action and potential in clinical settings for cancer treatment.
| CAS Number | 907957-34-0 |
| Synonyms | 2-(4-butylphenyl)-[1,2]thiazolo[5,4-b]pyridin-3-one |
| Molecular Formula | C16H16N2OS |
| Purity | ≥95% |
| IUPAC Name | 2-(4-butylphenyl)-[1,2]thiazolo[5,4-b]pyridin-3-one |
| InChI | InChI=1S/C16H16N2OS/c1-2-3-5-12-7-9-13(10-8-12)18-16(19)14-6-4-11-17-15(14)20-18/h4,6-11H,2-3,5H2,1H3 |
| InChIKey | XNGPPEMGIZDPGJ-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)N2C(=O)C3=C(S2)N=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
