For research use only. Not for therapeutic Use.
NSC260594(CAT: I040961) is a small molecule that induces apoptosis by binding to the shallow groove of the Mcl-1 protein, leading to the downregulation of Wnt signaling proteins and subsequent inhibition of Mcl-1 expression. This mechanism has shown efficacy in inhibiting tumor growth, particularly in triple-negative breast cancers (TNBCs). Additionally, NSC260594 can recognize the G9-G10-A11-G12 RNA tetraloop of HIV, preventing the binding of the Gag protein within the 5′-UTR, thereby inhibiting HIV-1 RNA encapsidation. Given these mechanisms, NSC260594 is relevant to both Cancer Disease Research and Infection Disease Research, with potential applications in studying TNBC and HIV-related pathologies.
CAS Number | 906718-66-9 |
Synonyms | 4-[(1-methyl-6-nitroquinolin-4-ylidene)amino]-N-[4-[(1-methylpyridin-4-ylidene)amino]phenyl]benzamide |
Molecular Formula | C29H24N6O3 |
Purity | ≥95% |
IUPAC Name | 4-[(1-methyl-6-nitroquinolin-4-ylidene)amino]-N-[4-[(1-methylpyridin-4-ylidene)amino]phenyl]benzamide |
InChI | InChI=1S/C29H24N6O3/c1-33-16-13-24(14-17-33)30-21-7-9-23(10-8-21)32-29(36)20-3-5-22(6-4-20)31-27-15-18-34(2)28-12-11-25(35(37)38)19-26(27)28/h3-19H,1-2H3,(H,32,36) |
InChIKey | SDVVSJQTYKFAFR-UHFFFAOYSA-N |
SMILES | CN1C=CC(=NC2=CC=C(C=C2)NC(=O)C3=CC=C(C=C3)N=C4C=CN(C5=C4C=C(C=C5)[N+](=O)[O-])C)C=C1 |