For research use only. Not for therapeutic Use.
NSC2805(Cat No.:I033586)is a potent inhibitor of the WWP2 ubiquitin ligase, exhibiting an IC₅₀ of 0.38 μM. WWP2, an E3 ubiquitin ligase, plays a crucial role in the ubiquitination and subsequent degradation of target proteins, including the tumor suppressor PTEN. By inhibiting WWP2, NSC2805 effectively reduces PTEN ubiquitination, leading to its stabilization and potential tumor-suppressive effects. This mechanism positions NSC2805 as a valuable compound for cancer research, offering insights into therapeutic strategies that modulate ubiquitin ligase activity to restore tumor suppressor functions.
CAS Number | 4371-34-0 |
Synonyms | 2-(2,5-dihydroxy-4-methylphenyl)-5-methylbenzene-1,4-diol |
Molecular Formula | C14H14O4 |
Purity | ≥95% |
IUPAC Name | 2-(2,5-dihydroxy-4-methylphenyl)-5-methylbenzene-1,4-diol |
InChI | InChI=1S/C14H14O4/c1-7-3-13(17)9(5-11(7)15)10-6-12(16)8(2)4-14(10)18/h3-6,15-18H,1-2H3 |
InChIKey | DSVRCBOSZSZMRX-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1O)C2=C(C=C(C(=C2)O)C)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |