For research use only. Not for therapeutic Use.
NSC305787 hydrochloride(Cat No.:I003970)is a small molecule compound studied for its potential anticancer properties. It works by inhibiting specific enzymes or proteins involved in cancer cell survival, proliferation, and metastasis. The compound has shown activity in preclinical models, particularly in targeting solid tumors and certain hematological cancers. By modulating cellular pathways, NSC305787 hydrochloride may enhance the efficacy of other cancer therapies. Ongoing research is focused on understanding its mechanism of action, optimizing its therapeutic potential, and evaluating its safety and efficacy in clinical trials for cancer treatment.
CAS Number | 53868-26-1 |
Molecular Formula | C25H31Cl3N2O |
Purity | ≥95% |
Target | PKC |
Solubility | DMSO: ≤ 8 mg/mL |
Storage | -20°C |
IUPAC Name | [2-(1-adamantyl)-6,8-dichloroquinolin-4-yl]-piperidin-2-ylmethanol;hydrochloride |
InChI | InChI=1S/C25H30Cl2N2O.ClH/c26-17-8-18-19(24(30)21-3-1-2-4-28-21)10-22(29-23(18)20(27)9-17)25-11-14-5-15(12-25)7-16(6-14)13-25;/h8-10,14-16,21,24,28,30H,1-7,11-13H2;1H |
InChIKey | JQALIVSYOXLOBE-UHFFFAOYSA-N |
SMILES | C1CCNC(C1)C(C2=CC(=NC3=C2C=C(C=C3Cl)Cl)C45CC6CC(C4)CC(C6)C5)O.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |