For research use only. Not for therapeutic Use.
NSC 319726 (Cat No.:I004668) is a small molecule that has been investigated for its potential anticancer properties. It functions as an inhibitor of specific signaling pathways involved in cell survival and proliferation, particularly in cancer cells. NSC319726 has shown promise in preclinical studies for its ability to suppress tumor growth, including in certain types of leukemia. Its exact mechanism of action is still under investigation, but it may target key proteins involved in cancer cell metabolism and apoptosis, offering potential for therapeutic use.
CAS Number | 71555-25-4 |
Synonyms | N-[(Z)-1-pyridin-2-ylethylideneamino]azetidine-1-carbothioamide |
Molecular Formula | C11H14N4S |
Purity | ≥95% |
Target | MDM-2/p53 |
Solubility | DMSO: ≤ 27.5 mg/mL |
Storage | Store at -20°C |
IC50 | 8 nM |
IUPAC Name | N-[(E)-1-pyridin-2-ylethylideneamino]azetidine-1-carbothioamide |
InChI | InChI=1S/C11H14N4S/c1-9(10-5-2-3-6-12-10)13-14-11(16)15-7-4-8-15/h2-3,5-6H,4,7-8H2,1H3,(H,14,16)/b13-9+ |
InChIKey | XDHBUMNIQRLHGO-UKTHLTGXSA-N |
SMILES | CC(=NNC(=S)N1CCC1)C2=CC=CC=N2 |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |