For research use only. Not for therapeutic Use.
NSC3852 (Cat No.:I010574) is a chemically distinct histone deacetylase (HDAC) inhibitor that possesses a unique Zn2+ chelation motif different from that of SAHA (suberoylanilide hydroxamic acid). HDAC inhibitors are a class of compounds that target enzymes involved in the regulation of gene expression by removing acetyl groups from histone proteins, thus altering the chromatin structure and gene transcription. NSC3852’s unique Zn2+ chelation motif allows it to interact with HDAC enzymes, potentially influencing their activity and leading to changes in gene expression.
CAS Number | 3565-26-2 |
Synonyms | 5-Nitroso-8-quinolinol |
Molecular Formula | C9H6N2O2 |
Purity | ≥95% |
Target | HDAC |
Solubility | Soluble to 100 mM in DMSO and to 10 mM in ethanol |
Storage | Store at RT |
IUPAC Name | 5-nitrosoquinolin-8-ol |
InChI | InChI=1S/C9H6N2O2/c12-8-4-3-7(11-13)6-2-1-5-10-9(6)8/h1-5,12H |
InChIKey | RZWRYPGAUIOOMK-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC(=C2N=C1)O)N=O |
Reference | 1: Strobl JS, Seibert CW, Li Y, Nagarkatti R, Mitchell SM, Rosypal AC, Rathore D, <br> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |