For research use only. Not for therapeutic Use.
NSC48280（Cat No.:I033625） is a bioactive chemical compound with potential pharmacological activities. It belongs to the class of N-substituted glycine and is commonly used as a research tool in various biological studies. NSC48280 may exhibit diverse biological effects depending on the specific context and target system. Its mode of action and specific biological targets may vary, making it important to consider the specific research or therapeutic application for a comprehensive understanding of its potential effects and mechanisms of action.
| Catalog Number | I033625 |
| CAS Number | 2425-41-4 |
| Synonyms | NSC48280; NSC-48280; NSC 48280; |
| Molecular Formula | C12H16O4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | liquid |
| Storage | Room Temperature |
| IUPAC Name | 1,3-Dioxane-5,5-dimethanol, 2-phenyl- (9CI) |
| InChI | InChI=1S/C12H16O4/c13-6-12(7-14)8-15-11(16-9-12)10-4-2-1-3-5-10/h1-5,11,13-14H,6-9H2 |
| InChIKey | DHWCGYXHBIWIPM-UHFFFAOYSA-N |
| SMILES | OCC1(CO)COC(C2=CC=CC=C2)OC1 |
