For research use only. Not for therapeutic Use.
NSC 49652（Cat No.:I033627）is a small molecule inhibitor that has shown promise in cancer research. It acts by targeting specific enzymes or proteins involved in cell signaling pathways crucial for cancer cell survival and proliferation. By disrupting these pathways, NSC 49652 can inhibit tumor growth and induce apoptosis in various cancer cell lines. Preclinical studies have demonstrated its potential as an anti-cancer agent, particularly in the treatment of hematologic malignancies. Further research is needed to better understand its full therapeutic potential and to explore its application in clinical trials.
| CAS Number | 908563-68-8 |
| Synonyms | (E)-1-(2-hydroxyphenyl)-3-pyridin-3-ylprop-2-en-1-one |
| Molecular Formula | C14H11NO2 |
| Purity | ≥95% |
| IUPAC Name | (E)-1-(2-hydroxyphenyl)-3-pyridin-3-ylprop-2-en-1-one |
| InChI | InChI=1S/C14H11NO2/c16-13-6-2-1-5-12(13)14(17)8-7-11-4-3-9-15-10-11/h1-10,16H/b8-7+ |
| InChIKey | CRWNZUBUBIULHB-BQYQJAHWSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)/C=C/C2=CN=CC=C2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
