For research use only. Not for therapeutic Use.
NSC57094 (Cat.No:I033630) is a chemical compound that has been investigated for its potential in cancer therapy. It belongs to the class of indole derivatives and has shown cytotoxic effects against various cancer cell lines. NSC57094 exhibits antiproliferative and pro-apoptotic activities, making it a candidate for further research in developing novel anticancer agents.
| Catalog Number | I033630 |
| CAS Number | 2455-71-2 |
| Synonyms | 1,3-Bis(3-phenoxyphenoxy)benzene; NSC57094; NSC 57094; NSC-57094; |
| Molecular Formula | C30H22O4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 1,3-Bis(3-phenoxyphenoxy)benzene |
| InChI | InChI=1S/C30H22O4/c1-3-10-23(11-4-1)31-25-14-7-16-27(20-25)33-29-18-9-19-30(22-29)34-28-17-8-15-26(21-28)32-24-12-5-2-6-13-24/h1-22H |
| InChIKey | KOKDSALTQSQPDH-UHFFFAOYSA-N |
| SMILES | C1(OC2=CC=CC(OC3=CC=CC=C3)=C2)=CC=CC(OC4=CC=CC(OC5=CC=CC=C5)=C4)=C1 |
