For research use only. Not for therapeutic Use.
NSC61610（Cat No.:I008375）is a small molecule compound that acts as an inhibitor of the enzyme phosphodiesterase 5 (PDE5). By inhibiting PDE5, NSC61610 can increase the levels of cyclic guanosine monophosphate (cGMP), a molecule involved in regulating vascular tone and smooth muscle relaxation. This mechanism suggests potential applications in the treatment of erectile dysfunction, pulmonary hypertension, and other cardiovascular conditions. Additionally, NSC61610 may have utility in research focused on modulating nitric oxide signaling pathways. Ongoing studies aim to explore its pharmacological profile and therapeutic potential in these and related diseases.
| CAS Number | 500538-94-3 |
| Synonyms | 1-N,4-N-bis[3-(1H-benzimidazol-2-yl)phenyl]benzene-1,4-dicarboxamide |
| Molecular Formula | C34H24N6O2 |
| Purity | ≥95% |
| IUPAC Name | 1-N,4-N-bis[3-(1H-benzimidazol-2-yl)phenyl]benzene-1,4-dicarboxamide |
| InChI | InChI=1S/C34H24N6O2/c41-33(35-25-9-5-7-23(19-25)31-37-27-11-1-2-12-28(27)38-31)21-15-17-22(18-16-21)34(42)36-26-10-6-8-24(20-26)32-39-29-13-3-4-14-30(29)40-32/h1-20H,(H,35,41)(H,36,42)(H,37,38)(H,39,40) |
| InChIKey | WSXIJTIFOWCMIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=CC(=CC=C3)NC(=O)C4=CC=C(C=C4)C(=O)NC5=CC=CC(=C5)C6=NC7=CC=CC=C7N6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
