For research use only. Not for therapeutic Use.
NSC61610 disrupts hIL-18 binding to the ectromelia virus IL-18BP. NSC61610 inhibits hIL-18:ectvIL-18BP complex formation with an IC50 about 6 uM[1].
NSC61610 has a predicted Ki value of 88 nM between β strands β5 and β8 (virtual screening)[1].
NSC61610 inhibits hIL-18:ectvIL-18BP complex formation with an IC50 about 6 uM[1].
| Catalog Number | I008375 |
| CAS Number | 500538-94-3 |
| Synonyms | 1-N,4-N-bis[3-(1H-benzimidazol-2-yl)phenyl]benzene-1,4-dicarboxamide |
| Molecular Formula | C34H24N6O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C34H24N6O2/c41-33(35-25-9-5-7-23(19-25)31-37-27-11-1-2-12-28(27)38-31)21-15-17-22(18-16-21)34(42)36-26-10-6-8-24(20-26)32-39-29-13-3-4-14-30(29)40-32/h1-20H,(H,35,41)(H,36,42)(H,37,38)(H,39,40) |
| InChIKey | WSXIJTIFOWCMIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=CC(=CC=C3)NC(=O)C4=CC=C(C=C4)C(=O)NC5=CC=CC(=C5)C6=NC7=CC=CC=C7N6 |
| Reference | [1]. Krumm B, et al. Identification of small molecule inhibitors of Interleukin-18. Sci Rep. 2017 Mar 28;7(1):483. |
