For research use only. Not for therapeutic Use.
NSC622608（Cat No.:I043388）is a small-molecule compound being studied for its potential therapeutic applications in cancer treatment. It is a selective inhibitor of specific enzymes involved in cancer cell proliferation, survival, and metastasis. NSC622608 targets key signaling pathways that regulate cell growth and may help to reduce tumor progression. Preclinical studies suggest that NSC622608 could be effective against certain types of cancer by suppressing the activity of proteins that promote tumor growth. Ongoing research is focused on evaluating its efficacy, safety, and potential for combination therapy in cancer treatment.
| CAS Number | 2593254-90-9 |
| Synonyms | 5-(furan-2-ylmethylimino)-N,N-dimethyl-1,2,4-dithiazol-3-amine;hydrobromide |
| Molecular Formula | C9H12BrN3OS2 |
| Purity | ≥95% |
| IUPAC Name | 5-(furan-2-ylmethylimino)-N,N-dimethyl-1,2,4-dithiazol-3-amine;hydrobromide |
| InChI | InChI=1S/C9H11N3OS2.BrH/c1-12(2)9-11-8(14-15-9)10-6-7-4-3-5-13-7;/h3-5H,6H2,1-2H3;1H |
| InChIKey | VVZWMEHUXGPOIY-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=NCC2=CC=CO2)SS1.Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
