For research use only. Not for therapeutic Use.
NSC756093（Cat No.:I012336）is a potent small molecule inhibitor that targets the kinase activity of Aurora A, a protein involved in regulating cell division. By inhibiting Aurora A, NSC756093 disrupts mitosis, leading to cell cycle arrest and potential tumor cell death. It is primarily studied for its potential in cancer research, as Aurora A is overexpressed in various tumors and contributes to uncontrolled cell proliferation. NSC756093 is used in preclinical studies to evaluate its effectiveness as a targeted cancer therapy, particularly in cancers associated with mitotic dysregulation and Aurora A overexpression.
| CAS Number | 1629908-92-4 |
| Synonyms | 4-(2-hydroxyethyl)-6-methoxy-9-phenyl-3,9-dihydrofuro[3,4-b]quinolin-1-one |
| Molecular Formula | C20H19NO4 |
| Purity | ≥95% |
| IUPAC Name | 4-(2-hydroxyethyl)-6-methoxy-9-phenyl-3,9-dihydrofuro[3,4-b]quinolin-1-one |
| InChI | InChI=1S/C20H19NO4/c1-24-14-7-8-15-16(11-14)21(9-10-22)17-12-25-20(23)19(17)18(15)13-5-3-2-4-6-13/h2-8,11,18,22H,9-10,12H2,1H3 |
| InChIKey | SMEJQLRLHKWIFV-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(C3=C(N2CCO)COC3=O)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
