For research use only. Not for therapeutic Use.
NSI-189 is a neurogenic compound originally developed for the treatment of major depressive disorder (MDD) and cognitive impairments. It is believed to stimulate neurogenesis in the hippocampus, a brain region associated with mood regulation and memory, by promoting the growth of new neurons. NSI-189 has been investigated for its potential to not only alleviate depressive symptoms but also improve cognitive function and overall brain health. Its unique mechanism of action makes it a promising candidate for treating neurodegenerative diseases, depression, and other conditions related to hippocampal dysfunction.
CAS Number | 1270138-40-3 |
Synonyms | ;(4-benzylpiperazin-1-yl)(2-(isopentylamino)pyridin-3-yl)methanone |
Molecular Formula | C22H30N4O |
Purity | ≥95% |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
Overview of Clinical Research | Originator Neuralstem |
IUPAC Name | (4-benzylpiperazin-1-yl)-[2-(3-methylbutylamino)pyridin-3-yl]methanone |
InChI | InChI=1S/C22H30N4O/c1-18(2)10-12-24-21-20(9-6-11-23-21)22(27)26-15-13-25(14-16-26)17-19-7-4-3-5-8-19/h3-9,11,18H,10,12-17H2,1-2H3,(H,23,24) |
InChIKey | DYTOQURYRYYNOR-UHFFFAOYSA-N |
SMILES | O=C(N1CCN(CC2=CC=CC=C2)CC1)C3=CC=CN=C3NCCC(C)C |