For research use only. Not for therapeutic Use.
NT160(Cat No.:I041190)is a novel small molecule under development for its potential therapeutic applications in autoimmune diseases and cancer. It targets specific immune pathways to modulate immune cell activation and reduce excessive inflammation, which plays a central role in conditions like rheumatoid arthritis and other inflammatory disorders. NT160 has demonstrated promising preclinical results in enhancing immune regulation while minimizing adverse effects. Ongoing clinical trials are focusing on evaluating its safety, efficacy, and ability to improve immune responses in autoimmune diseases and provide a targeted treatment approach in cancer therapy.
CAS Number | 1418293-40-9 |
Synonyms | N-[(2R)-1-[benzyl(methyl)amino]propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
Molecular Formula | C21H21F3N4O2 |
Purity | ≥95% |
IUPAC Name | N-[(2R)-1-[benzyl(methyl)amino]propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
InChI | InChI=1S/C21H21F3N4O2/c1-14(12-28(2)13-15-6-4-3-5-7-15)25-19(29)17-10-8-16(9-11-17)18-26-20(30-27-18)21(22,23)24/h3-11,14H,12-13H2,1-2H3,(H,25,29)/t14-/m1/s1 |
InChIKey | RESDVUQVZOJNSO-CQSZACIVSA-N |
SMILES | C[C@H](CN(C)CC1=CC=CC=C1)NC(=O)C2=CC=C(C=C2)C3=NOC(=N3)C(F)(F)F |