For research use only. Not for therapeutic Use.
NU 1025（Cat No.:I010181）is a selective inhibitor of poly(ADP-ribose) polymerase (PARP), an enzyme involved in DNA repair and cellular stress responses. By inhibiting PARP, NU 1025 interferes with the repair of single-strand DNA breaks, leading to the accumulation of DNA damage and subsequent cell death, particularly in cancer cells. This property makes NU 1025 a potential therapeutic agent in cancer treatment, especially when used in combination with DNA-damaging agents like chemotherapy. While preclinical studies show promise, further clinical research is needed to assess its efficacy, safety, and potential for treating various cancers.
| Catalog Number | I010181 |
| CAS Number | 90417-38-2 |
| Synonyms | 8-Hydroxy-2-methyl-4(3H)-quinazolinone;NSC 696807 |
| Molecular Formula | C9H8N2O2 |
| Purity | ≥95% |
| Target | Epigenetics |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Store at RT |
| IUPAC Name | 8-hydroxy-2-methyl-3H-quinazolin-4-one |
| InChI | InChI=1S/C9H8N2O2/c1-5-10-8-6(9(13)11-5)3-2-4-7(8)12/h2-4,12H,1H3,(H,10,11,13) |
| InChIKey | YJDAOHJWLUNFLX-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC=C2O)C(=O)N1 |
| Reference | 1: Bowman KJ, White A, Golding BT, Griffin RJ, Curtin NJ. Potentiation of anti-cancer agent cytotoxicity by the potent poly(ADP-ribose) polymerase inhibitors NU1025 and NU1064. Br J Cancer. 1998 Nov;78(10):1269-77. PubMed PMID: 9823965; PubMed Central PMCID: PMC2063197.<br /> |
