For research use only. Not for therapeutic Use.
NU 6140（Cat No.:R025361）is a selective inhibitor of glycogen synthase kinase 3 (GSK-3), an enzyme involved in numerous cellular processes, including glycogen metabolism, cell proliferation, and apoptosis. By inhibiting GSK-3, NU 6140 can modulate signaling pathways related to cancer, neurodegenerative diseases, and metabolic disorders. Preclinical studies have demonstrated its potential to enhance neuronal survival and promote neurogenesis, making it a candidate for treating conditions like Alzheimer’s disease. Additionally, NU 6140’s role in cancer research highlights its ability to disrupt tumor growth, positioning it as a promising therapeutic agent in various disease models.
| Catalog Number | R025361 |
| CAS Number | 444723-13-1 |
| Synonyms | 4-[[6-(Cyclohexylmethoxy)-1H-purin-2-yl]amino]-N,N-diethylbenzamide |
| Molecular Formula | C23H30N6O2 |
| Purity | ≥95% |
| Target | CDK inhibitor |
| Storage | -20°C |
| IUPAC Name | 4-[[6-(cyclohexylmethoxy)-7H-purin-2-yl]amino]-N,N-diethylbenzamide |
| InChI | InChI=1S/C23H30N6O2/c1-3-29(4-2)22(30)17-10-12-18(13-11-17)26-23-27-20-19(24-15-25-20)21(28-23)31-14-16-8-6-5-7-9-16/h10-13,15-16H,3-9,14H2,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | XHEQSRJCJTWWAH-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)NC2=NC3=C(C(=N2)OCC4CCCCC4)NC=N3 |
| Reference | </br>1: Pennati M, Campbell AJ, Curto M, Binda M, Cheng Y, Wang LZ, Curtin N, Golding BT, Griffin RJ, Hardcastle IR, Henderson A, Zaffaroni N, Newell DR. Potentiation of paclitaxel-induced apoptosis by the novel cyclin-dependent kinase inhibitor NU6140: a possible role for survivin down-regulation. Mol Cancer Ther. 2005 Sep;4(9):1328-37. PubMed PMID: 16170024.</br> |
