For research use only. Not for therapeutic Use.
NU 9056（Cat No.:R061900）is a selective inhibitor of the enzyme phosphodiesterase 4 (PDE4), known for its role in modulating inflammatory responses. By inhibiting PDE4, NU 9056 enhances intracellular levels of cyclic adenosine monophosphate (cAMP), leading to reduced inflammation and improved immune responses. This compound has shown potential in treating various inflammatory conditions, including asthma and chronic obstructive pulmonary disease (COPD). Its selectivity for PDE4 minimizes side effects associated with broader phosphodiesterase inhibition, making NU 9056 a promising candidate for therapeutic applications in inflammatory and respiratory diseases.
| Catalog Number | R061900 |
| CAS Number | 1450644-28-6 |
| Synonyms | 5-(1,2-Thiazol-5-yldisulfanyl)-1,2-thiazole |
| Molecular Formula | C6H4N2S4 |
| Purity | ≥95% |
| Target | Histone Acetyltransferases |
| Storage | Store at -20°C |
| IUPAC Name | 5-(1,2-thiazol-5-yldisulfanyl)-1,2-thiazole |
| InChI | InChI=1S/C6H4N2S4/c1-3-7-9-5(1)11-12-6-2-4-8-10-6/h1-4H |
| InChIKey | MLRAMCAHIWHWRM-UHFFFAOYSA-N |
| SMILES | C1=C(SN=C1)SSC2=CC=NS2 |
