For research use only. Not for therapeutic Use.
Nuciferine(Cat No.:I003660) is a bioactive alkaloid found in the leaves of the sacred lotus (Nelumbo nucifera), essential for advanced pharmacological research. Known for its diverse therapeutic properties, including anti-inflammatory, anti-diabetic, and neuroprotective effects, it plays a crucial role in studying various biochemical pathways. This high-purity compound ensures precise and reliable analytical results, making it ideal for experimental setups focused on natural product research and drug development. Nuciferine supports robust investigations into novel therapeutic applications, offering significant potential in the fields of neurology, metabolic disorders, and chronic disease management.
CAS Number | 475-83-2 |
Molecular Formula | C19H21NO2 |
Purity | ≥95% |
Documentation | |
Target | GPCR/G Protein |
Solubility | DMSO |
Storage | Store at -20°C |
IUPAC Name | (6aR)-1,2-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
InChI | InChI=1S/C19H21NO2/c1-20-9-8-13-11-16(21-2)19(22-3)18-14-7-5-4-6-12(14)10-15(20)17(13)18/h4-7,11,15H,8-10H2,1-3H3/t15-/m1/s1 |
InChIKey | ORJVQPIHKOARKV-OAHLLOKOSA-N |
SMILES | CN1CCC2=CC(=C(C3=C2C1CC4=CC=CC=C43)OC)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |