For research use only. Not for therapeutic Use.
Nurr1 agonist 4(Cat No.:I041093)is a small molecule designed to activate Nurr1 (nuclear receptor related 1), a transcription factor involved in the regulation of dopaminergic neuron development and function. By binding to and activating Nurr1, this agonist has the potential to promote the survival and regeneration of dopaminergic neurons, which are crucial for diseases like Parkinson’s disease. Nurr1 agonist 4 may also play a role in reducing neuroinflammation and improving motor function. It is being explored as a potential therapeutic agent for neurodegenerative diseases and disorders involving dopaminergic system dysfunction.
CAS Number | 87645-58-7 |
Synonyms | 5-(4-methoxyphenyl)furan-3-carboxylic acid |
Molecular Formula | C12H10O4 |
Purity | ≥95% |
IUPAC Name | 5-(4-methoxyphenyl)furan-3-carboxylic acid |
InChI | InChI=1S/C12H10O4/c1-15-10-4-2-8(3-5-10)11-6-9(7-16-11)12(13)14/h2-7H,1H3,(H,13,14) |
InChIKey | KGKSJJKOSONHJU-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C2=CC(=CO2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |