For research use only. Not for therapeutic Use.
Nutlin-3b（Cat No.:I004541）, also known as (+)-Nutlin-3, is a p53/MDM2 antagonist or inhibitor. It exhibits an IC50 value of 13.6 μM. Nutlin-3b is the (+)-enantiomer of Nutlin-3, while Nutlin-3a is the (-)-enantiomer. In vivo, studies have shown that Nutlin-3b is approximately 150 times less effective compared to Nutlin-3a. This difference in efficacy between the two enantiomers highlights the importance of stereochemistry in their interactions with the p53/MDM2 pathway.
| Catalog Number | I004541 |
| CAS Number | 675576-97-3 |
| Synonyms | 4-[(4R,5S)-4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one |
| Molecular Formula | C₃₀H₃₀Cl₂N₄O₄ |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | DMSO 100 mg/ml; Water <1 mg/ml |
| Storage | Store at -20°C |
| IC50 | 13.6 μM |
| IUPAC Name | 4-[(4R,5S)-4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one |
| InChI | InChI=1S/C30H30Cl2N4O4/c1-18(2)40-25-16-23(39-3)12-13-24(25)29-34-27(19-4-8-21(31)9-5-19)28(20-6-10-22(32)11-7-20)36(29)30(38)35-15-14-33-26(37)17-35/h4-13,16,18,27-28H,14-15,17H2,1-3H3,(H,33,37)/t27-,28+/m1/s1 |
| InChIKey | BDUHCSBCVGXTJM-IZLXSDGUSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1)OC)C2=NC(C(N2C(=O)N3CCNC(=O)C3)C4=CC=C(C=C4)Cl)C5=CC=C(C=C5)Cl |
| Reference | <p style=/line-height:25px/> |
