For research use only. Not for therapeutic Use.
NVR 3-778(Cat No.:I002039)is an investigational antiviral agent targeting hepatitis B virus (HBV) replication. As a capsid assembly modulator (CAM), it disrupts the formation of HBV nucleocapsids, inhibiting viral replication. Clinical studies have demonstrated that NVR 3-778 effectively reduces HBV DNA and RNA levels in patients, with enhanced efficacy observed when combined with pegylated interferon.Despite its promising antiviral activity, development of NVR 3-778 was discontinued due to limited efficacy at feasible doses and potential adverse effects.Nonetheless, its mechanism has informed the development of new CAMs for HBV treatment.
Catalog Number | I002039 |
CAS Number | 1445790-55-5 |
Molecular Formula | C18H16F4N2O4S |
Purity | ≥95% |
Target | HBV |
IUPAC Name | 4-fluoro-3-(4-hydroxypiperidin-1-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
InChI | InChI=1S/C18H16F4N2O4S/c19-13-2-1-10(18(26)23-11-8-14(20)17(22)15(21)9-11)7-16(13)29(27,28)24-5-3-12(25)4-6-24/h1-2,7-9,12,25H,3-6H2,(H,23,26) |
InChIKey | KKMFSVNFPUPGCA-UHFFFAOYSA-N |
SMILES | C1CN(CCC1O)S(=O)(=O)C2=C(C=CC(=C2)C(=O)NC3=CC(=C(C(=C3)F)F)F)F |