For research use only. Not for therapeutic Use.
NVS-SM2 is a small-molecule activator of myosin, primarily studied for its potential role in improving muscle contractility. By targeting the motor protein myosin, NVS-SM2 enhances the contractile force of skeletal muscles, making it a promising therapeutic candidate for conditions involving muscle weakness, such as spinal muscular atrophy (SMA) and other neuromuscular disorders. Its mechanism involves increasing the efficiency of the myosin-actin interaction, thus improving muscle function without excessive energy consumption. NVS-SM2’s ability to boost muscle performance makes it a valuable compound in muscle disease research and potential therapies for muscular impairments.
| Catalog Number | I008390 |
| CAS Number | 1562333-92-9 |
| Synonyms | 2-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-5-(1H-pyrazol-4-yl)phenol |
| Molecular Formula | C23H30N6O |
| Purity | ≥95% |
| InChI | InChI=1S/C23H30N6O/c1-22(2)11-17(12-23(3,4)28-22)29(5)21-9-8-19(26-27-21)18-7-6-15(10-20(18)30)16-13-24-25-14-16/h6-10,13-14,17,28,30H,11-12H2,1-5H3,(H,24,25) |
| InChIKey | XSBJQWNBBMWICJ-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)N(C)C2=NN=C(C=C2)C3=C(C=C(C=C3)C4=CNN=C4)O)C |
