For research use only. Not for therapeutic Use.
O-(2-Aminoethyl)-O’-(2-azidoethyl)pentaethylene glycol (Cat.No:R054678) is a chemical compound used in bioconjugation and drug delivery applications. It contains an azido group, allowing for click chemistry reactions with alkyne-functionalized molecules. The pentaethylene glycol linker provides stability and solubility, making it valuable in various biomedical research and therapeutic developments.
Catalog Number | R054678 |
CAS Number | 957486-82-7 |
Synonyms | 20-Azido-3,6,9,12,15,18-hexaoxaeicosan-1-amine; |
Molecular Formula | C14H30N4O6 |
Purity | ≥95% |
Target | Antibody-drug Conjugate/ADC Related |
Storage | Store at -20C |
IUPAC Name | 2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
InChI | InChI=1S/C14H30N4O6/c15-1-3-19-5-7-21-9-11-23-13-14-24-12-10-22-8-6-20-4-2-17-18-16/h1-15H2 |
InChIKey | VCQSTKKJKNUQBI-UHFFFAOYSA-N |
SMILES | C(COCCOCCOCCOCCOCCOCCN=[N+]=[N-])N |