For research use only. Not for therapeutic Use.
O-(2-Aminoethyl)-O’-[2-(Boc-amino)ethyl]triethylene glycol(Cat No.:R054696), is a chemical compound used in organic synthesis and as a building block for the preparation of complex molecules. It contains an aminoethyl group and a Boc-protected aminoethyl group attached to a triethylene glycol backbone. This compound is valuable in medicinal chemistry, peptide synthesis, and drug development, as it can be used to introduce specific functional groups and linkers into molecules for targeted drug delivery and other applications in pharmaceutical research and development.
CAS Number | 811442-84-9 |
Synonyms | 16-Amino-5,8,11,14-tetraoxa-2-azahexadecanoic Acid 1,1-Dimethylethyl Ester; Boc-amino-PEG-amine (n=4); Boc-NH-PEG4-CH2CH2NH2; |
Molecular Formula | C15H32N2O6 |
Purity | ≥95% |
Target | PROTAC |
Storage | 2-8°C(protect from light) |
IUPAC Name | tert-butyl N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
InChI | InChI=1S/C15H32N2O6/c1-15(2,3)23-14(18)17-5-7-20-9-11-22-13-12-21-10-8-19-6-4-16/h4-13,16H2,1-3H3,(H,17,18) |
InChIKey | WCNWLERBLMBSOT-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |