For research use only. Not for therapeutic Use.
O-Allylvanillin(CAT: I040649) is a synthetic derivative of vanillin, characterized by the substitution of a hydrogen atom in the hydroxyl group with an allyl group. This structural modification imparts unique physicochemical properties and enhances its potential for applications in organic synthesis, fragrance development, and pharmaceutical research. O-Allylvanillin retains the aromatic and sweet scent of vanillin while exhibiting increased reactivity, making it useful in the design of advanced functional materials, flavor modifiers, or bioactive compound intermediates.
CAS Number | 22280-95-1 |
Synonyms | 3-methoxy-4-prop-2-enoxybenzaldehyde |
Molecular Formula | C11H12O3 |
Purity | ≥95% |
IUPAC Name | 3-methoxy-4-prop-2-enoxybenzaldehyde |
InChI | InChI=1S/C11H12O3/c1-3-6-14-10-5-4-9(8-12)7-11(10)13-2/h3-5,7-8H,1,6H2,2H3 |
InChIKey | DGWCHURQYFMBFC-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)C=O)OCC=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |