For research use only. Not for therapeutic Use.
Arachidonoyl ethanolamide (AEA) was the first endogenous cannabinoid to be isolated and characterized as an agonist acting on the same receptors (CB<sub>1</sub> and CB<sub>2</sub>) as tetrahydrocannabinols (THC). Since that time, a number of related endocannabinoids have been isolated, most notably 2-<wbr></wbr>arachidonoyl glycerol (2-<wbr></wbr>AG). O-<wbr></wbr>Arachidonoyl ethanolamine hydrochloride (O-<wbr></wbr>AEA) is a recently isolated constituent of human and rat brain wherein the ethanolamine moiety is attached “backwards”, as an ester instead of an amide, as in AEA. O-<wbr></wbr>AEA has mixed agonist/antagonist activity at the CB<sub>1</sub> receptor and does not appear to be the native endogenous cannabinoid agonist at this receptor. This is in keeping with other observations that 2-<wbr></wbr>AG is the primary endogenous CB<sub>1</sub> receptor ligand.
| Catalog Number | R036075 |
| CAS Number | 443129-35-9 |
| Synonyms | O-AEA;Arachidonic Acid-(2-aminoethyl)-ester;Virodhamine |
| Molecular Formula | C22H38ClNO2 |
| Purity | ≥95% |
| Storage | -80°C |
| IUPAC Name | 2-aminoethyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate;hydrochloride |
| InChI | InChI=1S/C22H37NO2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(24)25-21-20-23;/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-21,23H2,1H3;1H/b7-6-,10-9-,13-12-,16-15-; |
| InChIKey | BNTZVCDZOZGRSZ-XVSDJDOKSA-N |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCCN.Cl |
