For research use only. Not for therapeutic Use.
O-Benzyl-D-serine is a key amino acid derivative used in advanced pharmaceutical and biochemical research. This compound is essential for studying protein synthesis, enzyme mechanisms, and peptide-based drug development. Its unique structure allows for the creation of novel bioactive compounds and detailed analysis of biochemical pathways. O-Benzyl-D-serine is highly valued for its purity and stability, making it an indispensable tool for researchers developing new therapeutics and exploring complex biological processes in molecular biology and pharmacology.
| Catalog Number | R022313 |
| CAS Number | 10433-52-0 |
| Synonyms | O-(Phenylmethyl)-D-serine; D-3-(Benzyloxy)-alanine; (R)-2-Amino-3-(benzyloxy)propanoic Acid |
| Molecular Formula | C10H13NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2R)-2-amino-3-phenylmethoxypropanoic acid |
| InChI | InChI=1S/C10H13NO3/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m1/s1 |
| InChIKey | IDGQXGPQOGUGIX-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)COCC(C(=O)O)N |
