For research use only. Not for therapeutic Use.
O-benzyl psilocin is a derivative of psilocin, a naturally occurring psychedelic compound found in certain mushrooms. This compound is synthesized by attaching a benzyl group to the oxygen atom of psilocin, potentially altering its pharmacological properties. Research on O-benzyl psilocin explores its synthesis, structural characterization, and psychoactive effects. Studies aim to understand its pharmacokinetics, receptor interactions, and potential therapeutic applications in mental health disorders, as well as its legality and safety profile.
| Catalog Number | R046591 |
| CAS Number | 28383-23-5 |
| Synonyms | N,N-Dimethyl-4-(phenylmethoxy)-1H-indole-3-ethanamine; 4-(Benzyloxy)-3-[2-(dimethylamino)ethyl]indole; 4-(Benzyloxy)-N,N-dimethyltryptamine; |
| Molecular Formula | C19H22N2O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N,N-dimethyl-2-(4-phenylmethoxy-1H-indol-3-yl)ethanamine |
| InChI | InChI=1S/C19H22N2O/c1-21(2)12-11-16-13-20-17-9-6-10-18(19(16)17)22-14-15-7-4-3-5-8-15/h3-10,13,20H,11-12,14H2,1-2H3 |
| InChIKey | LHERKDDDEMCCCU-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=CNC2=C1C(=CC=C2)OCC3=CC=CC=C3 |
