For research use only. Not for therapeutic Use.
o-Chloroanisole (Cat.No:R070287) is a chemical compound used in various industrial applications, including as a flavor and fragrance intermediate. Its structure includes a chlorine atom and a methoxy group attached to a benzene ring. o-Chloroanisole is known for its distinct aroma and is utilized in the creation of perfumes and scented products.
CAS Number | 766-51-8 |
Synonyms | 2-Chloroanisole |
Molecular Formula | C7H7ClO |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1-chloro-2-methoxybenzene |
InChI | InChI=1S/C7H7ClO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
InChIKey | QGRPVMLBTFGQDQ-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |