For research use only. Not for therapeutic Use.
o-Cresol (Cat.No:R018114) is an organic compound with a methylphenol structure. It’s a colorless to pale yellow liquid with a distinctive odor. o-Cresol is used in the production of antioxidants, disinfectants, and various industrial chemicals. It also finds applications in the synthesis of pharmaceuticals and agrochemicals.
| Catalog Number | R018114 |
| CAS Number | 95-48-7 |
| Synonyms | 1-Hydroxy-2-methylbenzene; 1-Methyl-2-hydroxybenzene; 2-Cresol; 2-Hydroxytoluene; 2-Methylphenol; NSC 23076; NSC 36809; o-Cresylic Acid; o-Hydroxytoluene; o-Methylphenol; o-Methylphenylol; o-Oxytoluene; o-Toluol; 2-Methylphenol |
| Molecular Formula | C7H8O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-methylphenol |
| InChI | InChI=1S/C7H8O/c1-6-4-2-3-5-7(6)8/h2-5,8H,1H3 |
| InChIKey | QWVGKYWNOKOFNN-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1O |
