For research use only. Not for therapeutic Use.
O-Cymene（Cat No.:L006966）, is an aromatic hydrocarbon classified as a monoterpene. It is a colorless liquid with a pleasant citrus odor, found naturally in essential oils from plants like thyme, cumin, and oregano. O-cymene exhibits antimicrobial properties and is used in the food and pharmaceutical industries as a flavoring and fragrance agent. Additionally, it serves as a precursor in the synthesis of various chemicals, including antioxidants and insecticides. Its versatile applications, natural occurrence, and pleasant aroma make it valuable in enhancing the sensory qualities of products and contributing to research in pharmaceutical and agricultural sciences.
| Catalog Number | L006966 |
| CAS Number | 527-84-4 |
| Molecular Formula | C10H14 |
| Purity | ≥95% |
| IUPAC Name | 1-methyl-2-propan-2-ylbenzene |
| InChI | InChI=1S/C10H14/c1-8(2)10-7-5-4-6-9(10)3/h4-8H,1-3H3 |
| InChIKey | WWRCMNKATXZARA-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(C)C |
