For research use only. Not for therapeutic Use.
O-Demethyl Lenvatinib hydrochloride（Cat No.:I041427）is an active metabolite of Lenvatinib, a tyrosine kinase inhibitor used primarily in cancer treatment. It selectively targets several receptor tyrosine kinases, including VEGFR, FGFR, and PDGFR, which are involved in tumor angiogenesis and growth. O-Demethyl Lenvatinib hydrochloride has similar pharmacological properties to its parent compound, contributing to its anti-cancer effects. It is being explored for its potential in treating various cancers, including hepatocellular carcinoma, renal cell carcinoma, and thyroid cancer. Ongoing research aims to assess its efficacy, safety, and clinical potential in combination therapies.
| Synonyms | 4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-7-hydroxyquinoline-6-carboxamide;hydrochloride |
| Molecular Formula | C20H18Cl2N4O4 |
| Purity | ≥95% |
| IUPAC Name | 4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-7-hydroxyquinoline-6-carboxamide;hydrochloride |
| InChI | InChI=1S/C20H17ClN4O4.ClH/c21-14-7-11(3-4-15(14)25-20(28)24-10-1-2-10)29-18-5-6-23-16-9-17(26)13(19(22)27)8-12(16)18;/h3-10,26H,1-2H2,(H2,22,27)(H2,24,25,28);1H |
| InChIKey | KMZOGLZCTDVLLW-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)NC2=C(C=C(C=C2)OC3=C4C=C(C(=CC4=NC=C3)O)C(=O)N)Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
