For research use only. Not for therapeutic Use.
O-Desmethylangolensin(Cat No.:M016523)is a metabolite of the soy isoflavone daidzein, produced by gut microbiota. It is known for its potential health benefits, including antioxidant, anti-inflammatory, and estrogenic activities. Research suggests that O-Desmethylangolensin may play a role in reducing the risk of hormone-related cancers, cardiovascular diseases, and osteoporosis. Its presence in individuals varies based on gut microbiota composition, influencing the health effects of soy consumption. As a biomarker for studying the metabolic effects of soy isoflavones, O-Desmethylangolensin is crucial in nutritional and clinical research.
CAS Number | 21255-69-6 |
Synonyms | O-desmethylangolensin;ORTHO-DESMETHYLANGOLENSIN;ODESMETHYLANGIOLENSIN;DESMETHYLANGOLENSIN hplc |
Molecular Formula | C15H14O4 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 1-(2,4-dihydroxyphenyl)-2-(4-hydroxyphenyl)propan-1-one |
InChI | InChI=1S/C15H14O4/c1-9(10-2-4-11(16)5-3-10)15(19)13-7-6-12(17)8-14(13)18/h2-9,16-18H,1H3 |
InChIKey | JDJPNKPFDDUBFV-UHFFFAOYSA-N |
SMILES | CC(C1=CC=C(C=C1)O)C(=O)C2=C(C=C(C=C2)O)O |