Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> O-Ethyl piperidine-1-carbothioate
For research use only. Not for therapeutic Use.
O-Ethyl piperidine-1-carbothioate (CAT: L005315) is a synthetic compound with potential applications in organic synthesis and chemical research. Its mode of action could involve reactions with other molecules, possibly participating in various chemical transformations. While specific uses can vary, compounds like this are often studied for their roles as reagents or building blocks in the synthesis of more complex molecules.
CAS Number | 56525-81-6 |
Molecular Formula | C8H15NOS |
Purity | ≥95% |
IUPAC Name | O-ethyl piperidine-1-carbothioate |
InChI | InChI=1S/C8H15NOS/c1-2-10-8(11)9-6-4-3-5-7-9/h2-7H2,1H3 |
InChIKey | YCXOMQXFITYRQP-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |