For research use only. Not for therapeutic Use.
O-Ethyl S-((2-(trifluoromethyl)pyridin-3-yl)methyl) carbonodithioate (Cat.No:L004195) is a significant compound in agrochemical research. Its unique structure, featuring a carbonodithioate group and a trifluoromethylpyridine moiety, imparts distinctive pesticidal properties. This compound is employed in the development of crop protection agents, highlighting its importance in modern agriculture.
CAS Number | 2107987-89-1 |
Molecular Formula | C10H10F3NOS2 |
Purity | ≥95% |
IUPAC Name | O-ethyl [2-(trifluoromethyl)pyridin-3-yl]methylsulfanylmethanethioate |
InChI | InChI=1S/C10H10F3NOS2/c1-2-15-9(16)17-6-7-4-3-5-14-8(7)10(11,12)13/h3-5H,2,6H2,1H3 |
InChIKey | UMCSAZCSNTWRPM-UHFFFAOYSA-N |
SMILES | CCOC(=S)SCC1=C(N=CC=C1)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |