For research use only. Not for therapeutic Use.
O-Ethylhydroxylamine-d5 hydrochloride（Cat No.:I041508）is a deuterated compound, used as a stable isotope-labeled reagent in chemical and pharmaceutical research. It is the deuterated form of O-ethylhydroxylamine hydrochloride, where the hydrogen atoms are replaced by deuterium (heavy hydrogen). This compound is primarily used in studies involving isotope labeling, such as metabolic tracking, reaction mechanism studies, and analytical chemistry. It helps in tracing and quantifying reaction intermediates in complex processes. O-Ethylhydroxylamine-d5 hydrochloride is valuable for enhancing the precision and accuracy of experimental results in various scientific applications.
| Catalog Number | I041508 |
| CAS Number | 118087-07-3 |
| Synonyms | O-(1,1,2,2,2-pentadeuterioethyl)hydroxylamine;hydrochloride |
| Molecular Formula | C2H3D5ClNO |
| Purity | ≥95% |
| IUPAC Name | O-(1,1,2,2,2-pentadeuterioethyl)hydroxylamine;hydrochloride |
| InChI | InChI=1S/C2H7NO.ClH/c1-2-4-3;/h2-3H2,1H3;1H/i1D3,2D2; |
| InChIKey | NUXCOKIYARRTDC-LUIAAVAXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])ON.Cl |
