For research use only. Not for therapeutic Use.
o-Hydroxycinnamaldehyde is an organic compound featuring a hydroxyl group ortho to an aldehyde on a cinnamaldehyde backbone. It is found in some essential oils and is used in flavorings, fragrances, and pharmaceuticals. Known for its antioxidant and antimicrobial properties, o-Hydroxycinnamaldehyde is studied for potential therapeutic applications, including anti-inflammatory and anticancer effects, making it a valuable compound in natural product research.
CAS Number | 60125-23-7 |
Molecular Formula | C9H8O2 |
Purity | ≥95% |
Storage | -20 ℃ |
IUPAC Name | (E)-3-(2-hydroxyphenyl)prop-2-enal |
InChI | InChI=1S/C9H8O2/c10-7-3-5-8-4-1-2-6-9(8)11/h1-7,11H/b5-3+ |
InChIKey | BSDNZCQPDVTDET-HWKANZROSA-N |
SMILES | C1=CC=C(C(=C1)C=CC=O)O |