For research use only. Not for therapeutic Use.
O-Methylpodocarpic acid(CAT: R068288) is a compound with significance in the field of natural product chemistry and pharmacology. This chemical is a derivative of podocarpic acid, a naturally occurring compound found in certain plants like Podocarpus species. O-Methylpodocarpic acid may be of interest for its potential pharmacological properties or as a precursor for the synthesis of novel bioactive compounds.
CAS Number | 10037-26-0 |
Synonyms | (+)-Podocarpic acid methyl ether; 12-Methoxypodocarpa-8,11,13-trien-15-oic acid |
Molecular Formula | C18 H24 O3 |
Purity | ≥95% |
Storage | RT |
InChI | 1S/C18H24O3/c1-17-9-4-10-18(2,16(19)20)15(17)8-6-12-5-7-13(21-3)11-14(12)17/h5,7,11,15H,4,6,8-10H2,1-3H3,(H,19,20)/t15-,17+,18-/m0/s1 |
InChIKey | WEGOBZDECLEAOK-JQHSSLGASA-N |
SMILES | c12[C@@]3([C@@H]([C@](C(=O)O)(C)CCC3)CCc1ccc(c2)OC)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |