For research use only. Not for therapeutic Use.
O-Pentylresorufin(Cat No.:R048106) is a synthetic substrate used in enzymatic assays to detect and quantify the activity of certain cytochrome P450 enzymes. Its mode of action involves being metabolized by cytochrome P450 enzymes, particularly CYP1A1 and CYP1A2, to produce a fluorescent compound called resorufin. Pharmacologically, O-pentylresorufin is not used as a therapeutic drug. Instead, it serves as a useful tool in pharmaceutical research and drug development to evaluate the enzymatic activity of specific cytochrome P450 isoforms and study drug metabolism and drug-drug interactions.
| Catalog Number | R048106 |
| CAS Number | 87687-03-4 |
| Synonyms | 7-(Pentyloxy)-3H-phenoxazin-3-one; 7-Pentoxyphenoxazone; 7-Pentoxyresorufin; |
| Molecular Formula | C17H17NO3 |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | Limited solubility |
| Storage | Store at -20C |
| IUPAC Name | 7-pentoxyphenoxazin-3-one |
| InChI | InChI=1S/C17H17NO3/c1-2-3-4-9-20-13-6-8-15-17(11-13)21-16-10-12(19)5-7-14(16)18-15/h5-8,10-11H,2-4,9H2,1H3 |
| InChIKey | ZPSOKQFFOYYPKC-UHFFFAOYSA-N |
| SMILES | CCCCCOC1=CC2=C(C=C1)N=C3C=CC(=O)C=C3O2 |
