For research use only. Not for therapeutic Use.
O-((Perfluorophenyl)methyl)hydroxylamine hydrochloride is a fluorinated organic compound utilized in chemical synthesis. It features a perfluorophenyl group, which imparts unique properties like high stability and reactivity. This compound is valuable in pharmaceuticals and agrochemicals for its role in creating complex molecules. Its distinct chemical characteristics make it a useful tool in advanced synthetic chemistry applications.
CAS Number | 57981-02-9 |
Synonyms | N-[(2,3,4,5,6-Pentafluorobenzyl)oxy]amine Hydrochloride; O-(Pentafluorobenzyl)hydroxyamine Hydrochloride; O-(Pentafluorobenzyl)hydroxylamine Hydrochloride; Hydroxylamine, O-[(pentafluorophenyl)methyl]- Hydrochloride; 2,3,4,5,6-Pentafluorobenzyloxyam |
Molecular Formula | C7H5ClF5NO |
Purity | ≥95% |
Storage | -20 ℃ |
IUPAC Name | O-[(2,3,4,5,6-pentafluorophenyl)methyl]hydroxylamine;hydrochloride |
InChI | InChI=1S/C7H4F5NO.ClH/c8-3-2(1-14-13)4(9)6(11)7(12)5(3)10;/h1,13H2;1H |
InChIKey | HVMVKNXIMUCYJA-UHFFFAOYSA-N |
SMILES | C(C1=C(C(=C(C(=C1F)F)F)F)F)ON.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |