Home
>
Isotope Labeled Compounds>Isotope Labeled Synthetic Intermediates>
>
o-Tolualdehyde-13C1 (carbonyl-13C)
For research use only. Not for therapeutic Use.
o-Tolualdehyde-13C1 (carbonyl-13C) is an isotopically labeled form of o-tolualdehyde, where the carbon atom in the carbonyl group (C=O) is replaced with carbon-13. This compound is particularly useful in organic synthesis, structural elucidation, and studies involving reaction mechanisms. The carbon-13 labeling allows for precise tracking and analysis using NMR spectroscopy and mass spectrometry, providing detailed insights into the behavior of the carbonyl group in chemical reactions. o-Tolualdehyde-13C1 is valuable in research focused on aldehyde chemistry, isotopic labeling experiments, and the study of substitution and oxidation reactions. Its stable isotope labeling makes it an essential tool for obtaining accurate data in synthetic chemistry and mechanistic studies, supporting the development of new chemical methodologies and the understanding of aldehyde reactivity.
Catalog Number | M109778 |
CAS Number | 138151-99-2 |
Molecular Formula | C7H13N3O2S2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 2-methylbenzaldehyde |
InChI | InChI=1S/C8H8O/c1-7-4-2-3-5-8(7)6-9/h2-6H,1H3/i6+1 |
InChIKey | BTFQKIATRPGRBS-PTQBSOBMSA-N |
SMILES | CC1=CC=CC=C1[13CH]=O |