For research use only. Not for therapeutic Use.
o-Toluic Acid-13C2 is a carbon-13 labeled version of o-Toluic Acid, with two carbon atoms replaced by the stable isotope 13C. This compound is essential for research in organic chemistry and biochemistry, particularly in studies involving reaction mechanisms, metabolic pathways, and isotope tracing. The 13C labeling allows for precise tracking in NMR spectroscopy and mass spectrometry, making o-Toluic Acid-13C2 a valuable tool for investigating the behavior of toluic acid derivatives in various chemical reactions and biological processes. It is ideal for researchers focused on studying aromatic acids and their role in complex chemical and metabolic systems.
CAS Number | 1346599-98-1 |
Synonyms | 2-Methylbenzoic Acid-13C2; NSC 2193-13C2; o-Methylbenzoic Acid-13C2; o-Toluylic Acid-13C2; 2-Methyl-benzoic Acid-13C2 |
Molecular Formula | C8H8O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-methylbenzoic acid |
InChI | InChI=1S/C8H8O2/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3,(H,9,10)/i1+1,8+1 |
InChIKey | ZWLPBLYKEWSWPD-AXZPNSSOSA-N |
SMILES | CC1=CC=CC=C1C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |