For research use only. Not for therapeutic Use.
o-Toluidine-d9(Cat No.:M042196) is a deuterated form of o-toluidine, where nine hydrogen atoms are replaced with deuterium, a heavier isotope of hydrogen. This modification significantly enhances the molecule’s stability and alters its physical properties, making it particularly useful in scientific research. Deuterated o-toluidine is commonly used in nuclear magnetic resonance (NMR) spectroscopy as a solvent or a standard, allowing for more precise and interference-free measurements of chemical environments. Additionally, its use in isotopic labeling studies helps in tracing and understanding the metabolic pathways of similarly structured compounds in chemical and biological systems.
CAS Number | 194423-47-7 |
Molecular Formula | C7H9N |
Purity | ≥95% |
Storage | RT |
IUPAC Name | N,N,2,3,4,5-hexadeuterio-6-(trideuteriomethyl)aniline |
InChI | InChI=1S/C7H9N/c1-6-4-2-3-5-7(6)8/h2-5H,8H2,1H3/i1D3,2D,3D,4D,5D/hD2 |
InChIKey | RNVCVTLRINQCPJ-LLZDZVHOSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])N([2H])[2H])[2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |