For research use only. Not for therapeutic Use.
O4I2 (CAT: I002167) is a potent inducer of Oct3/4 expression in various human cell lines, including human fibroblasts. Oct3/4, also known as POU5F1, is a critical transcription factor involved in maintaining pluripotency and self-renewal in embryonic stem cells. O4I2’s ability to induce Oct3/4 expression suggests its potential utility in cellular reprogramming or regenerative medicine applications, where the activation of pluripotency-associated genes is desirable. The compound’s specific mechanism of action and effects on cellular differentiation warrant further investigation for its potential role in stem cell research and related therapeutic strategies.
CAS Number | 165682-93-9 |
Synonyms | 2-[(4-chlorophenyl)amino]- 4-thiazolecarboxylic acid, ethyl ester |
Molecular Formula | C12H11ClN2O2S |
Purity | ≥95% |
Target | Oct3/4 |
Solubility | DMSO: ≥ 42 mg/mL |
Storage | -20°C |
IUPAC Name | ethyl 2-(4-chloroanilino)-1,3-thiazole-4-carboxylate |
InChI | InChI=1S/C12H11ClN2O2S/c1-2-17-11(16)10-7-18-12(15-10)14-9-5-3-8(13)4-6-9/h3-7H,2H2,1H3,(H,14,15) |
InChIKey | ULUBAPWNHROTEU-UHFFFAOYSA-N |
SMILES | ClC1=CC=C(NC2=NC(C(OCC)=O)=CS2)C=C1 |