For research use only. Not for therapeutic Use.
O In the process, AGT is alkylated and irreversibly inactivated. O O Inactivation of AGT increases the chemotherapeutic effectiveness of chloroethylating and methylating agents.
| Catalog Number | R000036 |
| CAS Number | 19916-73-5 |
| Synonyms | 6-(Phenylmethoxy)-9H-purin-2-amine; 2-Amino-6-(benzyloxy)purine; NSC 637037; |
| Molecular Formula | C12H11N5O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 6-phenylmethoxy-7H-purin-2-amine |
| InChI | InChI=1S/C12H11N5O/c13-12-16-10-9(14-7-15-10)11(17-12)18-6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H3,13,14,15,16,17) |
| InChIKey | KRWMERLEINMZFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=NC3=C2NC=N3)N |
