For research use only. Not for therapeutic Use.
Obacunone (Cat No.:R018791) is a naturally occurring triterpenoid found in citrus fruits and other plants. It exhibits diverse pharmacological activities, including anticancer, anti-inflammatory, and antioxidant properties. As a promising natural compound, Obacunone has attracted attention in medicinal research for its potential therapeutic applications. Its presence in fruits and plants makes it a valuable target for drug development and health-related investigations. However, additional studies are required to fully understand its medicinal benefits and explore its potential in various medical and pharmaceutical applications.
CAS Number | 751-03-1 |
Molecular Formula | C26H30O7 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 2-8°C |
IUPAC Name | InChI=1S/C26H30O7/c1-22(2)16-12-17(27)25(5)15(23(16,3)9-7-18(28)32-22)6-10-24(4)19(14-8-11-30-13-14)31-21(29)20-26(24,25)33-20/h7-9,11,13,15-16,19-20H,6,10,12H2,1-5H3/t15-,16+,19+,20-,23-,24+,25+,26-/m1/s1 |
InChI | InChI=1S/C26H30O7/c1-22(2)16-12-17(27)25(5)15(23(16,3)9-7-18(28)32-22)6-10-24(4)19(14-8-11-30-13-14)31-21(29)20-26(24,25)33-20/h7-9,11,13,15-16,19-20H,6,10,12H2,1-5H3/t15-,16+,19+,20-,23-,24+,25+,26-/m1/s1 |
InChIKey | MAYJEFRPIKEYBL-OASIGRBWSA-N |
SMILES | CC1(C2CC(=O)C3(C(C2(C=CC(=O)O1)C)CCC4(C35C(O5)C(=O)OC4C6=COC=C6)C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |