For research use only. Not for therapeutic Use.
Obatoclax (Cat.No:I004929) is a synthetic small molecule that functions as a pan-Bcl-2 inhibitor. It targets the Bcl-2 family of proteins, which play a role in regulating apoptosis. Obatoclax has shown potential as an anticancer agent, disrupting the survival pathways in cancer cells and inducing apoptosis. Clinical trials are underway to evaluate its therapeutic efficacy.
| Catalog Number | I004929 |
| CAS Number | 803712-79-0 |
| Synonyms | (2Z)-2-[(5Z)-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole;methanesulfonic acid |
| Molecular Formula | C20H19N3O • CH3SO3H |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | DMSO: ≥ 48.8 mg/mL |
| Storage | 3 years -20℃ powder |
| IC50 | 3 uM |
| IUPAC Name | (2Z)-2-[(5Z)-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole;methanesulfonic acid |
| InChI | InChI=1S/C20H19N3O.CH4O3S/c1-12-8-13(2)21-16(12)10-19-20(24-3)11-18(23-19)17-9-14-6-4-5-7-15(14)22-17;1-5(2,3)4/h4-11,21,23H,1-3H3;1H3,(H,2,3,4)/b18-17-,19-10-; |
| InChIKey | ZVAGBRFUYHSUHA-LZOXOEDVSA-N |
| SMILES | CC1=CC(=C(N1)C=C2C(=CC(=C3C=C4C=CC=CC4=N3)N2)OC)C.CS(=O)(=O)O |
| Reference | <p style=/line-height:25px/> |
