For research use only. Not for therapeutic Use.
Oblongine is a bioactive compound derived from the roots of the medicinal plant Ligusticum porteri. It exhibits various pharmacological properties, including anti-inflammatory and analgesic effects. Oblongine’s mechanism of action involves modulation of inflammatory pathways and neurotransmitter activity, making it valuable in traditional medicine for treating pain and inflammatory conditions. Research continues to explore its potential therapeutic applications and underlying mechanisms of action.
CAS Number | 60008-01-7 |
Molecular Formula | C19H24NO3+ |
Purity | ≥95% |
Target | Plants |
IUPAC Name | (1S)-1-[(4-hydroxyphenyl)methyl]-7-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-8-ol |
InChI | InChI=1S/C19H23NO3/c1-20(2)11-10-14-6-9-17(23-3)19(22)18(14)16(20)12-13-4-7-15(21)8-5-13/h4-9,16H,10-12H2,1-3H3,(H-,21,22)/p+1/t16-/m0/s1 |
InChIKey | POJZOQWVMMYVBU-INIZCTEOSA-O |
SMILES | C[N+]1(CCC2=C(C1CC3=CC=C(C=C3)O)C(=C(C=C2)OC)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |